C18H20N2O5 — CID 17403518
2,4,5-trimethoxy-N-[3-(methylcarbamoyl)phenyl]benzamide (PubChem CID 17403518) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is 2,4,5-trimethoxy-N-[3-(methylcarbamoyl)phenyl]benzamide.
| Compound Name | 2,4,5-trimethoxy-N-[3-(methylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 17403518 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 2,4,5-trimethoxy-N-[3-(methylcarbamoyl)phenyl]benzamide |
| SMILES | CNC(=O)c1cccc(NC(=O)c2cc(OC)c(OC)cc2OC)c1 |
| InChI | InChI=1S/C18H20N2O5/c1-19-17(21)11-6-5-7-12(8-11)20-18(22)13-9-15(24-3)16(25-4)10-14(13)23-2/h5-10H,1-4H3,(H,19,21)(H,20,22) |
| InChIKey | JBOWWGHGPDZJMS-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |