C18H21NO6 — CID 2200296
N-(3,5-dimethoxyphenyl)-2,4,5-trimethoxybenzamide (PubChem CID 2200296) has the molecular formula C18H21NO6 and a molecular weight of 347.37 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-2,4,5-trimethoxybenzamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-2,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 2200296 |
| Molecular Formula | C18H21NO6 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-2,4,5-trimethoxybenzamide |
| SMILES | COc1cc(NC(=O)c2cc(OC)c(OC)cc2OC)cc(OC)c1 |
| InChI | InChI=1S/C18H21NO6/c1-21-12-6-11(7-13(8-12)22-2)19-18(20)14-9-16(24-4)17(25-5)10-15(14)23-3/h6-10H,1-5H3,(H,19,20) |
| InChIKey | HOPZSGWWGFZCMD-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |