C20H23NO5 — CID 131949452
2,4,5-trimethoxy-N-[4-(2-methylprop-2-enoxy)phenyl]benzamide (PubChem CID 131949452) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is 2,4,5-trimethoxy-N-[4-(2-methylprop-2-enoxy)phenyl]benzamide.
| Compound Name | 2,4,5-trimethoxy-N-[4-(2-methylprop-2-enoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 131949452 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 2,4,5-trimethoxy-N-[4-(2-methylprop-2-enoxy)phenyl]benzamide |
| SMILES | C=C(C)COc1ccc(NC(=O)c2cc(OC)c(OC)cc2OC)cc1 |
| InChI | InChI=1S/C20H23NO5/c1-13(2)12-26-15-8-6-14(7-9-15)21-20(22)16-10-18(24-4)19(25-5)11-17(16)23-3/h6-11H,1,12H2,2-5H3,(H,21,22) |
| InChIKey | ASXALLYFIWWNTC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|