C18H21NO5 — CID 912703
N-(4-ethoxyphenyl)-2,4,5-trimethoxybenzamide (PubChem CID 912703) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2,4,5-trimethoxybenzamide.
| Compound Name | N-(4-ethoxyphenyl)-2,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 912703 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | N-(4-ethoxyphenyl)-2,4,5-trimethoxybenzamide |
| SMILES | CCOc1ccc(NC(=O)c2cc(OC)c(OC)cc2OC)cc1 |
| InChI | InChI=1S/C18H21NO5/c1-5-24-13-8-6-12(7-9-13)19-18(20)14-10-16(22-3)17(23-4)11-15(14)21-2/h6-11H,5H2,1-4H3,(H,19,20) |
| InChIKey | WUOQCVKTMFVJDN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |