C24H25NO6 — CID 24636994
N-[4-(4-ethoxyphenoxy)phenyl]-2,3,4-trimethoxybenzamide (PubChem CID 24636994) has the molecular formula C24H25NO6 and a molecular weight of 423.47 g/mol. Its IUPAC name is N-[4-(4-ethoxyphenoxy)phenyl]-2,3,4-trimethoxybenzamide.
| Compound Name | N-[4-(4-ethoxyphenoxy)phenyl]-2,3,4-trimethoxybenzamide |
|---|---|
| PubChem CID | 24636994 |
| Molecular Formula | C24H25NO6 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | N-[4-(4-ethoxyphenoxy)phenyl]-2,3,4-trimethoxybenzamide |
| SMILES | CCOc1ccc(Oc2ccc(NC(=O)c3ccc(OC)c(OC)c3OC)cc2)cc1 |
| InChI | InChI=1S/C24H25NO6/c1-5-30-17-10-12-19(13-11-17)31-18-8-6-16(7-9-18)25-24(26)20-14-15-21(27-2)23(29-4)22(20)28-3/h6-15H,5H2,1-4H3,(H,25,26) |
| InChIKey | MZVSEBBROCMALJ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |