C20H25NO4 — CID 9442096
N-(4-butylphenyl)-2,3,4-trimethoxybenzamide (PubChem CID 9442096) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is N-(4-butylphenyl)-2,3,4-trimethoxybenzamide.
| Compound Name | N-(4-butylphenyl)-2,3,4-trimethoxybenzamide |
|---|---|
| PubChem CID | 9442096 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | N-(4-butylphenyl)-2,3,4-trimethoxybenzamide |
| SMILES | CCCCc1ccc(NC(=O)c2ccc(OC)c(OC)c2OC)cc1 |
| InChI | InChI=1S/C20H25NO4/c1-5-6-7-14-8-10-15(11-9-14)21-20(22)16-12-13-17(23-2)19(25-4)18(16)24-3/h8-13H,5-7H2,1-4H3,(H,21,22) |
| InChIKey | RRKWKFFZASNXJA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |