C17H16F3NO5 — CID 7768109
2,3,4-trimethoxy-N-[4-(trifluoromethoxy)phenyl]benzamide (PubChem CID 7768109) has the molecular formula C17H16F3NO5 and a molecular weight of 371.31 g/mol. Its IUPAC name is 2,3,4-trimethoxy-N-[4-(trifluoromethoxy)phenyl]benzamide.
| Compound Name | 2,3,4-trimethoxy-N-[4-(trifluoromethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 7768109 |
| Molecular Formula | C17H16F3NO5 |
| Molecular Weight | 371.31 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 2,3,4-trimethoxy-N-[4-(trifluoromethoxy)phenyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(OC(F)(F)F)cc2)c(OC)c1OC |
| InChI | InChI=1S/C17H16F3NO5/c1-23-13-9-8-12(14(24-2)15(13)25-3)16(22)21-10-4-6-11(7-5-10)26-17(18,19)20/h4-9H,1-3H3,(H,21,22) |
| InChIKey | NLUFTDYSIRNXGK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |