C16H14F3NO4 — CID 24641310
2,3-dimethoxy-N-[4-(trifluoromethoxy)phenyl]benzamide (PubChem CID 24641310) has the molecular formula C16H14F3NO4 and a molecular weight of 341.29 g/mol. Its IUPAC name is 2,3-dimethoxy-N-[4-(trifluoromethoxy)phenyl]benzamide.
| Compound Name | 2,3-dimethoxy-N-[4-(trifluoromethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 24641310 |
| Molecular Formula | C16H14F3NO4 |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 2,3-dimethoxy-N-[4-(trifluoromethoxy)phenyl]benzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc(OC(F)(F)F)cc2)c1OC |
| InChI | InChI=1S/C16H14F3NO4/c1-22-13-5-3-4-12(14(13)23-2)15(21)20-10-6-8-11(9-7-10)24-16(17,18)19/h3-9H,1-2H3,(H,20,21) |
| InChIKey | CYPQLOGMTWDJGS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |