C22H21NO4 — CID 27650117
2,3-dimethoxy-N-(4-phenylmethoxyphenyl)benzamide (PubChem CID 27650117) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is 2,3-dimethoxy-N-(4-phenylmethoxyphenyl)benzamide.
| Compound Name | 2,3-dimethoxy-N-(4-phenylmethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 27650117 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 2,3-dimethoxy-N-(4-phenylmethoxyphenyl)benzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc(OCc3ccccc3)cc2)c1OC |
| InChI | InChI=1S/C22H21NO4/c1-25-20-10-6-9-19(21(20)26-2)22(24)23-17-11-13-18(14-12-17)27-15-16-7-4-3-5-8-16/h3-14H,15H2,1-2H3,(H,23,24) |
| InChIKey | HXJXWUFNZYQITE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |