C21H16NO4- — CID 7033170
2-[(4-phenylmethoxyphenyl)carbamoyl]benzoate (PubChem CID 7033170) has the molecular formula C21H16NO4- and a molecular weight of 346.36 g/mol. Its IUPAC name is 2-[(4-phenylmethoxyphenyl)carbamoyl]benzoate.
| Compound Name | 2-[(4-phenylmethoxyphenyl)carbamoyl]benzoate |
|---|---|
| PubChem CID | 7033170 |
| Molecular Formula | C21H16NO4- |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 2-[(4-phenylmethoxyphenyl)carbamoyl]benzoate |
| SMILES | O=C([O-])c1ccccc1C(=O)Nc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H17NO4/c23-20(18-8-4-5-9-19(18)21(24)25)22-16-10-12-17(13-11-16)26-14-15-6-2-1-3-7-15/h1-13H,14H2,(H,22,23)(H,24,25)/p-1 |
| InChIKey | INHJENBPAUBZII-UHFFFAOYSA-M |
| XLogP | 2.88 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |