C17H17F2NO — CID 8961049
N-(4-butylphenyl)-2,4-difluorobenzamide (PubChem CID 8961049) has the molecular formula C17H17F2NO and a molecular weight of 289.33 g/mol. Its IUPAC name is N-(4-butylphenyl)-2,4-difluorobenzamide.
| Compound Name | N-(4-butylphenyl)-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 8961049 |
| Molecular Formula | C17H17F2NO |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | N-(4-butylphenyl)-2,4-difluorobenzamide |
| SMILES | CCCCc1ccc(NC(=O)c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C17H17F2NO/c1-2-3-4-12-5-8-14(9-6-12)20-17(21)15-10-7-13(18)11-16(15)19/h5-11H,2-4H2,1H3,(H,20,21) |
| InChIKey | USHFETZCRZTFGT-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |