C18H17F2NO3 — CID 7760837
butyl 4-[(2,4-difluorobenzoyl)amino]benzoate (PubChem CID 7760837) has the molecular formula C18H17F2NO3 and a molecular weight of 333.33 g/mol. Its IUPAC name is butyl 4-[(2,4-difluorobenzoyl)amino]benzoate.
| Compound Name | butyl 4-[(2,4-difluorobenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 7760837 |
| Molecular Formula | C18H17F2NO3 |
| Molecular Weight | 333.33 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | butyl 4-[(2,4-difluorobenzoyl)amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C18H17F2NO3/c1-2-3-10-24-18(23)12-4-7-14(8-5-12)21-17(22)15-9-6-13(19)11-16(15)20/h4-9,11H,2-3,10H2,1H3,(H,21,22) |
| InChIKey | MSRUJIZBTMYBHB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.33 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|