C21H20FN3O3 — CID 46920237
butyl 4-[[3-(4-fluorophenyl)-1H-pyrazole-5-carbonyl]amino]benzoate (PubChem CID 46920237) has the molecular formula C21H20FN3O3 and a molecular weight of 381.41 g/mol. Its IUPAC name is butyl 4-[[3-(4-fluorophenyl)-1H-pyrazole-5-carbonyl]amino]benzoate.
| Compound Name | butyl 4-[[3-(4-fluorophenyl)-1H-pyrazole-5-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 46920237 |
| Molecular Formula | C21H20FN3O3 |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | butyl 4-[[3-(4-fluorophenyl)-1H-pyrazole-5-carbonyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)c2cc(-c3ccc(F)cc3)n[nH]2)cc1 |
| InChI | InChI=1S/C21H20FN3O3/c1-2-3-12-28-21(27)15-6-10-17(11-7-15)23-20(26)19-13-18(24-25-19)14-4-8-16(22)9-5-14/h4-11,13H,2-3,12H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | KMHURPQGSMTDQW-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|