C19H20FNO3S — CID 7228837
butyl 4-[[2-(4-fluorophenyl)sulfanylacetyl]amino]benzoate (PubChem CID 7228837) has the molecular formula C19H20FNO3S and a molecular weight of 361.44 g/mol. Its IUPAC name is butyl 4-[[2-(4-fluorophenyl)sulfanylacetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-(4-fluorophenyl)sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 7228837 |
| Molecular Formula | C19H20FNO3S |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | butyl 4-[[2-(4-fluorophenyl)sulfanylacetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)CSc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H20FNO3S/c1-2-3-12-24-19(23)14-4-8-16(9-5-14)21-18(22)13-25-17-10-6-15(20)7-11-17/h4-11H,2-3,12-13H2,1H3,(H,21,22) |
| InChIKey | OOTWBPJCIDEFKO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|