C17H21N5O3S — CID 2627274
butyl 4-[[2-(4,6-diaminopyrimidin-2-yl)sulfanylacetyl]amino]benzoate (PubChem CID 2627274) has the molecular formula C17H21N5O3S and a molecular weight of 375.45 g/mol. Its IUPAC name is butyl 4-[[2-(4,6-diaminopyrimidin-2-yl)sulfanylacetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-(4,6-diaminopyrimidin-2-yl)sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 2627274 |
| Molecular Formula | C17H21N5O3S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | butyl 4-[[2-(4,6-diaminopyrimidin-2-yl)sulfanylacetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)CSc2nc(N)cc(N)n2)cc1 |
| InChI | InChI=1S/C17H21N5O3S/c1-2-3-8-25-16(24)11-4-6-12(7-5-11)20-15(23)10-26-17-21-13(18)9-14(19)22-17/h4-7,9H,2-3,8,10H2,1H3,(H,20,23)(H4,18,19,21,22) |
| InChIKey | NXUXUPPUNZQFTL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 133.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|