C28H36N2O6S — CID 4046544
butyl 4-[3-[3-(4-butoxycarbonylanilino)-3-oxopropyl]sulfanylpropanoylamino]benzoate (PubChem CID 4046544) has the molecular formula C28H36N2O6S and a molecular weight of 528.67 g/mol. Its IUPAC name is butyl 4-[3-[3-(4-butoxycarbonylanilino)-3-oxopropyl]sulfanylpropanoylamino]benzoate.
| Compound Name | butyl 4-[3-[3-(4-butoxycarbonylanilino)-3-oxopropyl]sulfanylpropanoylamino]benzoate |
|---|---|
| PubChem CID | 4046544 |
| Molecular Formula | C28H36N2O6S |
| Molecular Weight | 528.67 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | butyl 4-[3-[3-(4-butoxycarbonylanilino)-3-oxopropyl]sulfanylpropanoylamino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)CCSCCC(=O)Nc2ccc(C(=O)OCCCC)cc2)cc1 |
| InChI | InChI=1S/C28H36N2O6S/c1-3-5-17-35-27(33)21-7-11-23(12-8-21)29-25(31)15-19-37-20-16-26(32)30-24-13-9-22(10-14-24)28(34)36-18-6-4-2/h7-14H,3-6,15-20H2,1-2H3,(H,29,31)(H,30,32) |
| InChIKey | BIXXODCYLNDIIB-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.67 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|