C21H22ClNO4 — CID 108808160
butyl 4-[[4-(4-chlorophenyl)-4-oxobutanoyl]amino]benzoate (PubChem CID 108808160) has the molecular formula C21H22ClNO4 and a molecular weight of 387.86 g/mol. Its IUPAC name is butyl 4-[[4-(4-chlorophenyl)-4-oxobutanoyl]amino]benzoate.
| Compound Name | butyl 4-[[4-(4-chlorophenyl)-4-oxobutanoyl]amino]benzoate |
|---|---|
| PubChem CID | 108808160 |
| Molecular Formula | C21H22ClNO4 |
| Molecular Weight | 387.86 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | butyl 4-[[4-(4-chlorophenyl)-4-oxobutanoyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)CCC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H22ClNO4/c1-2-3-14-27-21(26)16-6-10-18(11-7-16)23-20(25)13-12-19(24)15-4-8-17(22)9-5-15/h4-11H,2-3,12-14H2,1H3,(H,23,25) |
| InChIKey | QNTYKCNZGALVEQ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.86 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|