C23H24FNO6 — CID 4219345
butyl 4-[[4-[2-(4-fluorophenyl)-2-oxoethoxy]-4-oxobutanoyl]amino]benzoate (PubChem CID 4219345) has the molecular formula C23H24FNO6 and a molecular weight of 429.44 g/mol. Its IUPAC name is butyl 4-[[4-[2-(4-fluorophenyl)-2-oxoethoxy]-4-oxobutanoyl]amino]benzoate.
| Compound Name | butyl 4-[[4-[2-(4-fluorophenyl)-2-oxoethoxy]-4-oxobutanoyl]amino]benzoate |
|---|---|
| PubChem CID | 4219345 |
| Molecular Formula | C23H24FNO6 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | butyl 4-[[4-[2-(4-fluorophenyl)-2-oxoethoxy]-4-oxobutanoyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)CCC(=O)OCC(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H24FNO6/c1-2-3-14-30-23(29)17-6-10-19(11-7-17)25-21(27)12-13-22(28)31-15-20(26)16-4-8-18(24)9-5-16/h4-11H,2-3,12-15H2,1H3,(H,25,27) |
| InChIKey | GUZZLXBXTJGRRV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|