C24H25F3N2O6 — CID 17260342
butyl 4-[[2-[4-oxo-4-[3-(trifluoromethyl)anilino]butanoyl]oxyacetyl]amino]benzoate (PubChem CID 17260342) has the molecular formula C24H25F3N2O6 and a molecular weight of 494.47 g/mol. Its IUPAC name is butyl 4-[[2-[4-oxo-4-[3-(trifluoromethyl)anilino]butanoyl]oxyacetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[4-oxo-4-[3-(trifluoromethyl)anilino]butanoyl]oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 17260342 |
| Molecular Formula | C24H25F3N2O6 |
| Molecular Weight | 494.47 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | butyl 4-[[2-[4-oxo-4-[3-(trifluoromethyl)anilino]butanoyl]oxyacetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)COC(=O)CCC(=O)Nc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C24H25F3N2O6/c1-2-3-13-34-23(33)16-7-9-18(10-8-16)28-21(31)15-35-22(32)12-11-20(30)29-19-6-4-5-17(14-19)24(25,26)27/h4-10,14H,2-3,11-13,15H2,1H3,(H,28,31)(H,29,30) |
| InChIKey | GKAAGUOVBYGYNI-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|