C27H25F3N2O4 — CID 28639227
3-phenylpropyl 4-oxo-4-[4-[[3-(trifluoromethyl)phenyl]carbamoyl]anilino]butanoate (PubChem CID 28639227) has the molecular formula C27H25F3N2O4 and a molecular weight of 498.50 g/mol. Its IUPAC name is 3-phenylpropyl 4-oxo-4-[4-[[3-(trifluoromethyl)phenyl]carbamoyl]anilino]butanoate.
| Compound Name | 3-phenylpropyl 4-oxo-4-[4-[[3-(trifluoromethyl)phenyl]carbamoyl]anilino]butanoate |
|---|---|
| PubChem CID | 28639227 |
| Molecular Formula | C27H25F3N2O4 |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | 3-phenylpropyl 4-oxo-4-[4-[[3-(trifluoromethyl)phenyl]carbamoyl]anilino]butanoate |
| SMILES | O=C(CCC(=O)OCCCc1ccccc1)Nc1ccc(C(=O)Nc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C27H25F3N2O4/c28-27(29,30)21-9-4-10-23(18-21)32-26(35)20-11-13-22(14-12-20)31-24(33)15-16-25(34)36-17-5-8-19-6-2-1-3-7-19/h1-4,6-7,9-14,18H,5,8,15-17H2,(H,31,33)(H,32,35) |
| InChIKey | CDDAZLPDQGKHKJ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|