C24H30N2O4 — CID 28639431
3-phenylpropyl 4-[3-(tert-butylcarbamoyl)anilino]-4-oxobutanoate (PubChem CID 28639431) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is 3-phenylpropyl 4-[3-(tert-butylcarbamoyl)anilino]-4-oxobutanoate.
| Compound Name | 3-phenylpropyl 4-[3-(tert-butylcarbamoyl)anilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 28639431 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 3-phenylpropyl 4-[3-(tert-butylcarbamoyl)anilino]-4-oxobutanoate |
| SMILES | CC(C)(C)NC(=O)c1cccc(NC(=O)CCC(=O)OCCCc2ccccc2)c1 |
| InChI | InChI=1S/C24H30N2O4/c1-24(2,3)26-23(29)19-12-7-13-20(17-19)25-21(27)14-15-22(28)30-16-8-11-18-9-5-4-6-10-18/h4-7,9-10,12-13,17H,8,11,14-16H2,1-3H3,(H,25,27)(H,26,29) |
| InChIKey | RLDXVOQRBXMHEJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|