C24H29F3N2O2 — CID 46500977
4-(decanoylamino)-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 46500977) has the molecular formula C24H29F3N2O2 and a molecular weight of 434.50 g/mol. Its IUPAC name is 4-(decanoylamino)-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-(decanoylamino)-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 46500977 |
| Molecular Formula | C24H29F3N2O2 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 4-(decanoylamino)-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | CCCCCCCCCC(=O)Nc1ccc(C(=O)Nc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C24H29F3N2O2/c1-2-3-4-5-6-7-8-12-22(30)28-20-15-13-18(14-16-20)23(31)29-21-11-9-10-19(17-21)24(25,26)27/h9-11,13-17H,2-8,12H2,1H3,(H,28,30)(H,29,31) |
| InChIKey | YPRVMZRRSPXNSY-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|