C44H54N4O4 — CID 17232408
N,N'-bis[3-[(4-tert-butylbenzoyl)amino]phenyl]decanediamide (PubChem CID 17232408) has the molecular formula C44H54N4O4 and a molecular weight of 702.94 g/mol. Its IUPAC name is N,N'-bis[3-[(4-tert-butylbenzoyl)amino]phenyl]decanediamide.
| Compound Name | N,N'-bis[3-[(4-tert-butylbenzoyl)amino]phenyl]decanediamide |
|---|---|
| PubChem CID | 17232408 |
| Molecular Formula | C44H54N4O4 |
| Molecular Weight | 702.94 g/mol |
| Exact Mass | 702.41 |
| IUPAC Name | N,N'-bis[3-[(4-tert-butylbenzoyl)amino]phenyl]decanediamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2cccc(NC(=O)CCCCCCCCC(=O)Nc3cccc(NC(=O)c4ccc(C(C)(C)C)cc4)c3)c2)cc1 |
| InChI | InChI=1S/C44H54N4O4/c1-43(2,3)33-25-21-31(22-26-33)41(51)47-37-17-13-15-35(29-37)45-39(49)19-11-9-7-8-10-12-20-40(50)46-36-16-14-18-38(30-36)48-42(52)32-23-27-34(28-24-32)44(4,5)6/h13-18,21-30H,7-12,19-20H2,1-6H3,(H,45,49)(H,46,50)(H,47,51)(H,48,52) |
| InChIKey | ZPHRXOROHNCABH-UHFFFAOYSA-N |
| XLogP | 10.48 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.94 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|