C26H29N3O2 — CID 54795397
N-[3-[3-(4-aminophenyl)propanoylamino]phenyl]-4-tert-butylbenzamide (PubChem CID 54795397) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is N-[3-[3-(4-aminophenyl)propanoylamino]phenyl]-4-tert-butylbenzamide.
| Compound Name | N-[3-[3-(4-aminophenyl)propanoylamino]phenyl]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 54795397 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | N-[3-[3-(4-aminophenyl)propanoylamino]phenyl]-4-tert-butylbenzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2cccc(NC(=O)CCc3ccc(N)cc3)c2)cc1 |
| InChI | InChI=1S/C26H29N3O2/c1-26(2,3)20-12-10-19(11-13-20)25(31)29-23-6-4-5-22(17-23)28-24(30)16-9-18-7-14-21(27)15-8-18/h4-8,10-15,17H,9,16,27H2,1-3H3,(H,28,30)(H,29,31) |
| InChIKey | ITJATEORMHTLRE-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|