C24H23BrN2O2 — CID 3100149
N-[3-[(4-bromobenzoyl)amino]phenyl]-4-tert-butylbenzamide (PubChem CID 3100149) has the molecular formula C24H23BrN2O2 and a molecular weight of 451.36 g/mol. Its IUPAC name is N-[3-[(4-bromobenzoyl)amino]phenyl]-4-tert-butylbenzamide.
| Compound Name | N-[3-[(4-bromobenzoyl)amino]phenyl]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 3100149 |
| Molecular Formula | C24H23BrN2O2 |
| Molecular Weight | 451.36 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | N-[3-[(4-bromobenzoyl)amino]phenyl]-4-tert-butylbenzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2cccc(NC(=O)c3ccc(Br)cc3)c2)cc1 |
| InChI | InChI=1S/C24H23BrN2O2/c1-24(2,3)18-11-7-16(8-12-18)22(28)26-20-5-4-6-21(15-20)27-23(29)17-9-13-19(25)14-10-17/h4-15H,1-3H3,(H,26,28)(H,27,29) |
| InChIKey | KTZLAPZLXVFXMC-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.36 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |