C23H25N3O7 — CID 17259572
propyl 4-[[4-[2-(2-benzoylhydrazinyl)-2-oxoethoxy]-4-oxobutanoyl]amino]benzoate (PubChem CID 17259572) has the molecular formula C23H25N3O7 and a molecular weight of 455.47 g/mol. Its IUPAC name is propyl 4-[[4-[2-(2-benzoylhydrazinyl)-2-oxoethoxy]-4-oxobutanoyl]amino]benzoate.
| Compound Name | propyl 4-[[4-[2-(2-benzoylhydrazinyl)-2-oxoethoxy]-4-oxobutanoyl]amino]benzoate |
|---|---|
| PubChem CID | 17259572 |
| Molecular Formula | C23H25N3O7 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | propyl 4-[[4-[2-(2-benzoylhydrazinyl)-2-oxoethoxy]-4-oxobutanoyl]amino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NC(=O)CCC(=O)OCC(=O)NNC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H25N3O7/c1-2-14-32-23(31)17-8-10-18(11-9-17)24-19(27)12-13-21(29)33-15-20(28)25-26-22(30)16-6-4-3-5-7-16/h3-11H,2,12-15H2,1H3,(H,24,27)(H,25,28)(H,26,30) |
| InChIKey | PTHKLEBPPQZWGI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 139.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|