C25H30N2O6 — CID 17087333
2-methylpropyl 4-[[4-[2-(2-ethylanilino)-2-oxoethoxy]-4-oxobutanoyl]amino]benzoate (PubChem CID 17087333) has the molecular formula C25H30N2O6 and a molecular weight of 454.52 g/mol. Its IUPAC name is 2-methylpropyl 4-[[4-[2-(2-ethylanilino)-2-oxoethoxy]-4-oxobutanoyl]amino]benzoate.
| Compound Name | 2-methylpropyl 4-[[4-[2-(2-ethylanilino)-2-oxoethoxy]-4-oxobutanoyl]amino]benzoate |
|---|---|
| PubChem CID | 17087333 |
| Molecular Formula | C25H30N2O6 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 2-methylpropyl 4-[[4-[2-(2-ethylanilino)-2-oxoethoxy]-4-oxobutanoyl]amino]benzoate |
| SMILES | CCc1ccccc1NC(=O)COC(=O)CCC(=O)Nc1ccc(C(=O)OCC(C)C)cc1 |
| InChI | InChI=1S/C25H30N2O6/c1-4-18-7-5-6-8-21(18)27-23(29)16-32-24(30)14-13-22(28)26-20-11-9-19(10-12-20)25(31)33-15-17(2)3/h5-12,17H,4,13-16H2,1-3H3,(H,26,28)(H,27,29) |
| InChIKey | ZDKBCFWUUIWVJE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |