C22H26N2O4 — CID 9067633
[2-(2,5-dimethylanilino)-2-oxoethyl] 4-(2-ethylanilino)-4-oxobutanoate (PubChem CID 9067633) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is [2-(2,5-dimethylanilino)-2-oxoethyl] 4-(2-ethylanilino)-4-oxobutanoate.
| Compound Name | [2-(2,5-dimethylanilino)-2-oxoethyl] 4-(2-ethylanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 9067633 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | [2-(2,5-dimethylanilino)-2-oxoethyl] 4-(2-ethylanilino)-4-oxobutanoate |
| SMILES | CCc1ccccc1NC(=O)CCC(=O)OCC(=O)Nc1cc(C)ccc1C |
| InChI | InChI=1S/C22H26N2O4/c1-4-17-7-5-6-8-18(17)23-20(25)11-12-22(27)28-14-21(26)24-19-13-15(2)9-10-16(19)3/h5-10,13H,4,11-12,14H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | DTPHUMJESUPOMS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |