C23H28N2O4 — CID 9067652
[2-(2-ethylanilino)-2-oxoethyl] 5-(2-ethylanilino)-5-oxopentanoate (PubChem CID 9067652) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is [2-(2-ethylanilino)-2-oxoethyl] 5-(2-ethylanilino)-5-oxopentanoate.
| Compound Name | [2-(2-ethylanilino)-2-oxoethyl] 5-(2-ethylanilino)-5-oxopentanoate |
|---|---|
| PubChem CID | 9067652 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | [2-(2-ethylanilino)-2-oxoethyl] 5-(2-ethylanilino)-5-oxopentanoate |
| SMILES | CCc1ccccc1NC(=O)CCCC(=O)OCC(=O)Nc1ccccc1CC |
| InChI | InChI=1S/C23H28N2O4/c1-3-17-10-5-7-12-19(17)24-21(26)14-9-15-23(28)29-16-22(27)25-20-13-8-6-11-18(20)4-2/h5-8,10-13H,3-4,9,14-16H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | PEIAIGUSOXKQJT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |