C18H18ClNO3 — CID 8579246
[2-(2-ethylanilino)-2-oxoethyl] 2-(4-chlorophenyl)acetate (PubChem CID 8579246) has the molecular formula C18H18ClNO3 and a molecular weight of 331.80 g/mol. Its IUPAC name is [2-(2-ethylanilino)-2-oxoethyl] 2-(4-chlorophenyl)acetate.
| Compound Name | [2-(2-ethylanilino)-2-oxoethyl] 2-(4-chlorophenyl)acetate |
|---|---|
| PubChem CID | 8579246 |
| Molecular Formula | C18H18ClNO3 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | [2-(2-ethylanilino)-2-oxoethyl] 2-(4-chlorophenyl)acetate |
| SMILES | CCc1ccccc1NC(=O)COC(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H18ClNO3/c1-2-14-5-3-4-6-16(14)20-17(21)12-23-18(22)11-13-7-9-15(19)10-8-13/h3-10H,2,11-12H2,1H3,(H,20,21) |
| InChIKey | TZUOMJJBWONOAL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |