C17H16BrNO3 — CID 2570002
[2-(2-methylanilino)-2-oxoethyl] 2-(4-bromophenyl)acetate (PubChem CID 2570002) has the molecular formula C17H16BrNO3 and a molecular weight of 362.22 g/mol. Its IUPAC name is [2-(2-methylanilino)-2-oxoethyl] 2-(4-bromophenyl)acetate.
| Compound Name | [2-(2-methylanilino)-2-oxoethyl] 2-(4-bromophenyl)acetate |
|---|---|
| PubChem CID | 2570002 |
| Molecular Formula | C17H16BrNO3 |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | [2-(2-methylanilino)-2-oxoethyl] 2-(4-bromophenyl)acetate |
| SMILES | Cc1ccccc1NC(=O)COC(=O)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H16BrNO3/c1-12-4-2-3-5-15(12)19-16(20)11-22-17(21)10-13-6-8-14(18)9-7-13/h2-9H,10-11H2,1H3,(H,19,20) |
| InChIKey | WLCFCGWSXJRAOA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |