C17H15BrClNO3 — CID 7825839
[2-(3-chloro-2-methylanilino)-2-oxoethyl] 2-(4-bromophenyl)acetate (PubChem CID 7825839) has the molecular formula C17H15BrClNO3 and a molecular weight of 396.67 g/mol. Its IUPAC name is [2-(3-chloro-2-methylanilino)-2-oxoethyl] 2-(4-bromophenyl)acetate.
| Compound Name | [2-(3-chloro-2-methylanilino)-2-oxoethyl] 2-(4-bromophenyl)acetate |
|---|---|
| PubChem CID | 7825839 |
| Molecular Formula | C17H15BrClNO3 |
| Molecular Weight | 396.67 g/mol |
| Exact Mass | 394.99 |
| IUPAC Name | [2-(3-chloro-2-methylanilino)-2-oxoethyl] 2-(4-bromophenyl)acetate |
| SMILES | Cc1c(Cl)cccc1NC(=O)COC(=O)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H15BrClNO3/c1-11-14(19)3-2-4-15(11)20-16(21)10-23-17(22)9-12-5-7-13(18)8-6-12/h2-8H,9-10H2,1H3,(H,20,21) |
| InChIKey | IFPBCOCQRRYXKQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.67 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |