C17H18BrClN2O — CID 2657306
2-[(4-bromophenyl)methyl-methylamino]-N-(3-chloro-2-methylphenyl)acetamide (PubChem CID 2657306) has the molecular formula C17H18BrClN2O and a molecular weight of 381.70 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl-methylamino]-N-(3-chloro-2-methylphenyl)acetamide.
| Compound Name | 2-[(4-bromophenyl)methyl-methylamino]-N-(3-chloro-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 2657306 |
| Molecular Formula | C17H18BrClN2O |
| Molecular Weight | 381.70 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | 2-[(4-bromophenyl)methyl-methylamino]-N-(3-chloro-2-methylphenyl)acetamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)CN(C)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H18BrClN2O/c1-12-15(19)4-3-5-16(12)20-17(22)11-21(2)10-13-6-8-14(18)9-7-13/h3-9H,10-11H2,1-2H3,(H,20,22) |
| InChIKey | UGSWNTKAQRKASB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.70 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |