C24H21BrN2O4 — CID 30684694
[2-(4-bromo-2-methylanilino)-2-oxoethyl] 2-[(2-phenylacetyl)amino]benzoate (PubChem CID 30684694) has the molecular formula C24H21BrN2O4 and a molecular weight of 481.35 g/mol. Its IUPAC name is [2-(4-bromo-2-methylanilino)-2-oxoethyl] 2-[(2-phenylacetyl)amino]benzoate.
| Compound Name | [2-(4-bromo-2-methylanilino)-2-oxoethyl] 2-[(2-phenylacetyl)amino]benzoate |
|---|---|
| PubChem CID | 30684694 |
| Molecular Formula | C24H21BrN2O4 |
| Molecular Weight | 481.35 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | [2-(4-bromo-2-methylanilino)-2-oxoethyl] 2-[(2-phenylacetyl)amino]benzoate |
| SMILES | Cc1cc(Br)ccc1NC(=O)COC(=O)c1ccccc1NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C24H21BrN2O4/c1-16-13-18(25)11-12-20(16)26-23(29)15-31-24(30)19-9-5-6-10-21(19)27-22(28)14-17-7-3-2-4-8-17/h2-13H,14-15H2,1H3,(H,26,29)(H,27,28) |
| InChIKey | XZVOJBAWDQWDIA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.35 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |