C27H26N2O5 — CID 46793438
[2-oxo-2-[(3-oxo-1-phenylbutan-2-yl)amino]ethyl] 2-[(2-phenylacetyl)amino]benzoate (PubChem CID 46793438) has the molecular formula C27H26N2O5 and a molecular weight of 458.51 g/mol. Its IUPAC name is [2-oxo-2-[(3-oxo-1-phenylbutan-2-yl)amino]ethyl] 2-[(2-phenylacetyl)amino]benzoate.
| Compound Name | [2-oxo-2-[(3-oxo-1-phenylbutan-2-yl)amino]ethyl] 2-[(2-phenylacetyl)amino]benzoate |
|---|---|
| PubChem CID | 46793438 |
| Molecular Formula | C27H26N2O5 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | [2-oxo-2-[(3-oxo-1-phenylbutan-2-yl)amino]ethyl] 2-[(2-phenylacetyl)amino]benzoate |
| SMILES | CC(=O)C(Cc1ccccc1)NC(=O)COC(=O)c1ccccc1NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C27H26N2O5/c1-19(30)24(16-20-10-4-2-5-11-20)29-26(32)18-34-27(33)22-14-8-9-15-23(22)28-25(31)17-21-12-6-3-7-13-21/h2-15,24H,16-18H2,1H3,(H,28,31)(H,29,32) |
| InChIKey | CWCFDXGBYUKBPU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |