C19H17F2NO4 — CID 46816147
[2-oxo-2-[(3-oxo-1-phenylbutan-2-yl)amino]ethyl] 3,4-difluorobenzoate (PubChem CID 46816147) has the molecular formula C19H17F2NO4 and a molecular weight of 361.34 g/mol. Its IUPAC name is [2-oxo-2-[(3-oxo-1-phenylbutan-2-yl)amino]ethyl] 3,4-difluorobenzoate.
| Compound Name | [2-oxo-2-[(3-oxo-1-phenylbutan-2-yl)amino]ethyl] 3,4-difluorobenzoate |
|---|---|
| PubChem CID | 46816147 |
| Molecular Formula | C19H17F2NO4 |
| Molecular Weight | 361.34 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | [2-oxo-2-[(3-oxo-1-phenylbutan-2-yl)amino]ethyl] 3,4-difluorobenzoate |
| SMILES | CC(=O)C(Cc1ccccc1)NC(=O)COC(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H17F2NO4/c1-12(23)17(9-13-5-3-2-4-6-13)22-18(24)11-26-19(25)14-7-8-15(20)16(21)10-14/h2-8,10,17H,9,11H2,1H3,(H,22,24) |
| InChIKey | JPPWLCKYAHMDPH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |