C19H19ClN2O4 — CID 7864614
[2-oxo-2-[[(2S)-3-oxo-1-phenylbutan-2-yl]amino]ethyl] 2-amino-4-chlorobenzoate (PubChem CID 7864614) has the molecular formula C19H19ClN2O4 and a molecular weight of 374.82 g/mol. Its IUPAC name is [2-oxo-2-[[(2S)-3-oxo-1-phenylbutan-2-yl]amino]ethyl] 2-amino-4-chlorobenzoate.
| Compound Name | [2-oxo-2-[[(2S)-3-oxo-1-phenylbutan-2-yl]amino]ethyl] 2-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 7864614 |
| Molecular Formula | C19H19ClN2O4 |
| Molecular Weight | 374.82 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | [2-oxo-2-[[(2S)-3-oxo-1-phenylbutan-2-yl]amino]ethyl] 2-amino-4-chlorobenzoate |
| SMILES | CC(=O)[C@H](Cc1ccccc1)NC(=O)COC(=O)c1ccc(Cl)cc1N |
| InChI | InChI=1S/C19H19ClN2O4/c1-12(23)17(9-13-5-3-2-4-6-13)22-18(24)11-26-19(25)15-8-7-14(20)10-16(15)21/h2-8,10,17H,9,11,21H2,1H3,(H,22,24)/t17-/m0/s1 |
| InChIKey | MDYAXCFEFYVEGW-KRWDZBQOSA-N |
| XLogP | 2.40 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.82 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|