C17H16Cl2N2O3 — CID 7509062
[2-[[(1R)-1-(3-chlorophenyl)ethyl]amino]-2-oxoethyl] 2-amino-4-chlorobenzoate (PubChem CID 7509062) has the molecular formula C17H16Cl2N2O3 and a molecular weight of 367.23 g/mol. Its IUPAC name is [2-[[(1R)-1-(3-chlorophenyl)ethyl]amino]-2-oxoethyl] 2-amino-4-chlorobenzoate.
| Compound Name | [2-[[(1R)-1-(3-chlorophenyl)ethyl]amino]-2-oxoethyl] 2-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 7509062 |
| Molecular Formula | C17H16Cl2N2O3 |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | [2-[[(1R)-1-(3-chlorophenyl)ethyl]amino]-2-oxoethyl] 2-amino-4-chlorobenzoate |
| SMILES | C[C@@H](NC(=O)COC(=O)c1ccc(Cl)cc1N)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H16Cl2N2O3/c1-10(11-3-2-4-12(18)7-11)21-16(22)9-24-17(23)14-6-5-13(19)8-15(14)20/h2-8,10H,9,20H2,1H3,(H,21,22)/t10-/m1/s1 |
| InChIKey | UCXWDXAHRQHXBF-SNVBAGLBSA-N |
| XLogP | 3.61 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|