C19H19ClN2O5 — CID 18192212
[2-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylamino]-2-oxoethyl] 2-amino-4-chlorobenzoate (PubChem CID 18192212) has the molecular formula C19H19ClN2O5 and a molecular weight of 390.82 g/mol. Its IUPAC name is [2-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylamino]-2-oxoethyl] 2-amino-4-chlorobenzoate.
| Compound Name | [2-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylamino]-2-oxoethyl] 2-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 18192212 |
| Molecular Formula | C19H19ClN2O5 |
| Molecular Weight | 390.82 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | [2-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylamino]-2-oxoethyl] 2-amino-4-chlorobenzoate |
| SMILES | CC(NC(=O)COC(=O)c1ccc(Cl)cc1N)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C19H19ClN2O5/c1-11(12-2-5-16-17(8-12)26-7-6-25-16)22-18(23)10-27-19(24)14-4-3-13(20)9-15(14)21/h2-5,8-9,11H,6-7,10,21H2,1H3,(H,22,23) |
| InChIKey | KAMTWEXANLVCPB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.82 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|