C21H23FN2O5 — CID 16567332
[2-[[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]amino]-2-oxoethyl] 2-amino-4-fluorobenzoate (PubChem CID 16567332) has the molecular formula C21H23FN2O5 and a molecular weight of 402.42 g/mol. Its IUPAC name is [2-[[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]amino]-2-oxoethyl] 2-amino-4-fluorobenzoate.
| Compound Name | [2-[[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]amino]-2-oxoethyl] 2-amino-4-fluorobenzoate |
|---|---|
| PubChem CID | 16567332 |
| Molecular Formula | C21H23FN2O5 |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | [2-[[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]amino]-2-oxoethyl] 2-amino-4-fluorobenzoate |
| SMILES | CC(C)C(NC(=O)COC(=O)c1ccc(F)cc1N)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C21H23FN2O5/c1-12(2)20(13-3-6-17-18(9-13)28-8-7-27-17)24-19(25)11-29-21(26)15-5-4-14(22)10-16(15)23/h3-6,9-10,12,20H,7-8,11,23H2,1-2H3,(H,24,25) |
| InChIKey | QCEVEKZYGPZNCZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|