C18H15Cl2NO5 — CID 16523264
[2-[1-(1,3-benzodioxol-5-yl)ethylamino]-2-oxoethyl] 3,5-dichlorobenzoate (PubChem CID 16523264) has the molecular formula C18H15Cl2NO5 and a molecular weight of 396.23 g/mol. Its IUPAC name is [2-[1-(1,3-benzodioxol-5-yl)ethylamino]-2-oxoethyl] 3,5-dichlorobenzoate.
| Compound Name | [2-[1-(1,3-benzodioxol-5-yl)ethylamino]-2-oxoethyl] 3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 16523264 |
| Molecular Formula | C18H15Cl2NO5 |
| Molecular Weight | 396.23 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | [2-[1-(1,3-benzodioxol-5-yl)ethylamino]-2-oxoethyl] 3,5-dichlorobenzoate |
| SMILES | CC(NC(=O)COC(=O)c1cc(Cl)cc(Cl)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H15Cl2NO5/c1-10(11-2-3-15-16(6-11)26-9-25-15)21-17(22)8-24-18(23)12-4-13(19)7-14(20)5-12/h2-7,10H,8-9H2,1H3,(H,21,22) |
| InChIKey | YNJMNQAAZBEYCZ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.23 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |