C18H18ClNO4 — CID 7416496
[2-[[(1R)-1-(3-chlorophenyl)ethyl]amino]-2-oxoethyl] 2-hydroxy-3-methylbenzoate (PubChem CID 7416496) has the molecular formula C18H18ClNO4 and a molecular weight of 347.80 g/mol. Its IUPAC name is [2-[[(1R)-1-(3-chlorophenyl)ethyl]amino]-2-oxoethyl] 2-hydroxy-3-methylbenzoate.
| Compound Name | [2-[[(1R)-1-(3-chlorophenyl)ethyl]amino]-2-oxoethyl] 2-hydroxy-3-methylbenzoate |
|---|---|
| PubChem CID | 7416496 |
| Molecular Formula | C18H18ClNO4 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | [2-[[(1R)-1-(3-chlorophenyl)ethyl]amino]-2-oxoethyl] 2-hydroxy-3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)OCC(=O)N[C@H](C)c2cccc(Cl)c2)c1O |
| InChI | InChI=1S/C18H18ClNO4/c1-11-5-3-8-15(17(11)22)18(23)24-10-16(21)20-12(2)13-6-4-7-14(19)9-13/h3-9,12,22H,10H2,1-2H3,(H,20,21)/t12-/m1/s1 |
| InChIKey | UBZHACAYHQUIDB-GFCCVEGCSA-N |
| XLogP | 3.39 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |