C21H23NO6S — CID 8857117
[2-oxo-2-[[(2R)-3-oxo-1-phenylbutan-2-yl]amino]ethyl] 2-ethylsulfonylbenzoate (PubChem CID 8857117) has the molecular formula C21H23NO6S and a molecular weight of 417.48 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-3-oxo-1-phenylbutan-2-yl]amino]ethyl] 2-ethylsulfonylbenzoate.
| Compound Name | [2-oxo-2-[[(2R)-3-oxo-1-phenylbutan-2-yl]amino]ethyl] 2-ethylsulfonylbenzoate |
|---|---|
| PubChem CID | 8857117 |
| Molecular Formula | C21H23NO6S |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | [2-oxo-2-[[(2R)-3-oxo-1-phenylbutan-2-yl]amino]ethyl] 2-ethylsulfonylbenzoate |
| SMILES | CCS(=O)(=O)c1ccccc1C(=O)OCC(=O)N[C@H](Cc1ccccc1)C(C)=O |
| InChI | InChI=1S/C21H23NO6S/c1-3-29(26,27)19-12-8-7-11-17(19)21(25)28-14-20(24)22-18(15(2)23)13-16-9-5-4-6-10-16/h4-12,18H,3,13-14H2,1-2H3,(H,22,24)/t18-/m1/s1 |
| InChIKey | WTVCSDIPWDIGCF-GOSISDBHSA-N |
| XLogP | 1.95 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |