C24H24N2O5 — CID 7150103
[2-oxo-2-[[(2S)-3-oxo-1-phenylbutan-2-yl]amino]ethyl] 2-(furan-2-ylmethylamino)benzoate (PubChem CID 7150103) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is [2-oxo-2-[[(2S)-3-oxo-1-phenylbutan-2-yl]amino]ethyl] 2-(furan-2-ylmethylamino)benzoate.
| Compound Name | [2-oxo-2-[[(2S)-3-oxo-1-phenylbutan-2-yl]amino]ethyl] 2-(furan-2-ylmethylamino)benzoate |
|---|---|
| PubChem CID | 7150103 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | [2-oxo-2-[[(2S)-3-oxo-1-phenylbutan-2-yl]amino]ethyl] 2-(furan-2-ylmethylamino)benzoate |
| SMILES | CC(=O)[C@H](Cc1ccccc1)NC(=O)COC(=O)c1ccccc1NCc1ccco1 |
| InChI | InChI=1S/C24H24N2O5/c1-17(27)22(14-18-8-3-2-4-9-18)26-23(28)16-31-24(29)20-11-5-6-12-21(20)25-15-19-10-7-13-30-19/h2-13,22,25H,14-16H2,1H3,(H,26,28)/t22-/m0/s1 |
| InChIKey | BYPORJADLISPQK-QFIPXVFZSA-N |
| XLogP | 3.37 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |