C18H21N3O5 — CID 2613697
[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 2-(furan-2-ylmethylamino)benzoate (PubChem CID 2613697) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 2-(furan-2-ylmethylamino)benzoate.
| Compound Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 2-(furan-2-ylmethylamino)benzoate |
|---|---|
| PubChem CID | 2613697 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 2-(furan-2-ylmethylamino)benzoate |
| SMILES | CC(C)NC(=O)NC(=O)COC(=O)c1ccccc1NCc1ccco1 |
| InChI | InChI=1S/C18H21N3O5/c1-12(2)20-18(24)21-16(22)11-26-17(23)14-7-3-4-8-15(14)19-10-13-6-5-9-25-13/h3-9,12,19H,10-11H2,1-2H3,(H2,20,21,22,24) |
| InChIKey | RTCQSRGGBVBMCI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |