C20H24N2O4 — CID 2613807
[2-(cyclohexylamino)-2-oxoethyl] 2-(furan-2-ylmethylamino)benzoate (PubChem CID 2613807) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is [2-(cyclohexylamino)-2-oxoethyl] 2-(furan-2-ylmethylamino)benzoate.
| Compound Name | [2-(cyclohexylamino)-2-oxoethyl] 2-(furan-2-ylmethylamino)benzoate |
|---|---|
| PubChem CID | 2613807 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | [2-(cyclohexylamino)-2-oxoethyl] 2-(furan-2-ylmethylamino)benzoate |
| SMILES | O=C(COC(=O)c1ccccc1NCc1ccco1)NC1CCCCC1 |
| InChI | InChI=1S/C20H24N2O4/c23-19(22-15-7-2-1-3-8-15)14-26-20(24)17-10-4-5-11-18(17)21-13-16-9-6-12-25-16/h4-6,9-12,15,21H,1-3,7-8,13-14H2,(H,22,23) |
| InChIKey | MROCLSBNMIIEAB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |