C22H28N2O4 — CID 27315400
[(2R)-1-(cycloheptylamino)-1-oxopropan-2-yl] 2-(furan-2-ylmethylamino)benzoate (PubChem CID 27315400) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is [(2R)-1-(cycloheptylamino)-1-oxopropan-2-yl] 2-(furan-2-ylmethylamino)benzoate.
| Compound Name | [(2R)-1-(cycloheptylamino)-1-oxopropan-2-yl] 2-(furan-2-ylmethylamino)benzoate |
|---|---|
| PubChem CID | 27315400 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | [(2R)-1-(cycloheptylamino)-1-oxopropan-2-yl] 2-(furan-2-ylmethylamino)benzoate |
| SMILES | C[C@@H](OC(=O)c1ccccc1NCc1ccco1)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C22H28N2O4/c1-16(21(25)24-17-9-4-2-3-5-10-17)28-22(26)19-12-6-7-13-20(19)23-15-18-11-8-14-27-18/h6-8,11-14,16-17,23H,2-5,9-10,15H2,1H3,(H,24,25)/t16-/m1/s1 |
| InChIKey | WKYWSQCYVVYKGE-MRXNPFEDSA-N |
| XLogP | 4.28 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |