C17H24N2O3 — CID 24530551
[1-(cyclohexylamino)-1-oxopropan-2-yl] 2-(methylamino)benzoate (PubChem CID 24530551) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is [1-(cyclohexylamino)-1-oxopropan-2-yl] 2-(methylamino)benzoate.
| Compound Name | [1-(cyclohexylamino)-1-oxopropan-2-yl] 2-(methylamino)benzoate |
|---|---|
| PubChem CID | 24530551 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | [1-(cyclohexylamino)-1-oxopropan-2-yl] 2-(methylamino)benzoate |
| SMILES | CNc1ccccc1C(=O)OC(C)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C17H24N2O3/c1-12(16(20)19-13-8-4-3-5-9-13)22-17(21)14-10-6-7-11-15(14)18-2/h6-7,10-13,18H,3-5,8-9H2,1-2H3,(H,19,20) |
| InChIKey | GGXBQXDVOPCXTI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |