C18H25N3O4 — CID 7373033
[(2R)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 2-(methylamino)benzoate (PubChem CID 7373033) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is [(2R)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 2-(methylamino)benzoate.
| Compound Name | [(2R)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 2-(methylamino)benzoate |
|---|---|
| PubChem CID | 7373033 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | [(2R)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 2-(methylamino)benzoate |
| SMILES | CNc1ccccc1C(=O)O[C@H](C)C(=O)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C18H25N3O4/c1-12(25-17(23)14-10-6-7-11-15(14)19-2)16(22)21-18(24)20-13-8-4-3-5-9-13/h6-7,10-13,19H,3-5,8-9H2,1-2H3,(H2,20,21,22,24)/t12-/m1/s1 |
| InChIKey | MHLXPTDMKUOSOP-GFCCVEGCSA-N |
| XLogP | 2.43 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |