C18H23N3O6 — CID 8709913
[(2S)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 2-methyl-3-nitrobenzoate (PubChem CID 8709913) has the molecular formula C18H23N3O6 and a molecular weight of 377.40 g/mol. Its IUPAC name is [(2S)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 2-methyl-3-nitrobenzoate.
| Compound Name | [(2S)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 2-methyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 8709913 |
| Molecular Formula | C18H23N3O6 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | [(2S)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 2-methyl-3-nitrobenzoate |
| SMILES | Cc1c(C(=O)O[C@@H](C)C(=O)NC(=O)NC2CCCCC2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H23N3O6/c1-11-14(9-6-10-15(11)21(25)26)17(23)27-12(2)16(22)20-18(24)19-13-7-4-3-5-8-13/h6,9-10,12-13H,3-5,7-8H2,1-2H3,(H2,19,20,22,24)/t12-/m0/s1 |
| InChIKey | VUHUXAAJHLGKBO-LBPRGKRZSA-N |
| XLogP | 2.61 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|